C24H30O6 — CID 67989850
3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanedioic acid (PubChem CID 67989850) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanedioic acid.
| Compound Name | 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 67989850 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanedioic acid |
| SMILES | Cc1cc(CC(CC(=O)O)C(CC(=O)O)Cc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C24H30O6/c1-13-5-17(6-14(2)23(13)29)9-19(11-21(25)26)20(12-22(27)28)10-18-7-15(3)24(30)16(4)8-18/h5-8,19-20,29-30H,9-12H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | MNWJADWNEBZTEU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |