C15H20O3S — CID 88681507
3-[3,5-dimethyl-4-(3-oxobutyl)phenyl]-2-sulfanylpropanoic acid (PubChem CID 88681507) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-(3-oxobutyl)phenyl]-2-sulfanylpropanoic acid.
| Compound Name | 3-[3,5-dimethyl-4-(3-oxobutyl)phenyl]-2-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88681507 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[3,5-dimethyl-4-(3-oxobutyl)phenyl]-2-sulfanylpropanoic acid |
| SMILES | CC(=O)CCc1c(C)cc(CC(S)C(=O)O)cc1C |
| InChI | InChI=1S/C15H20O3S/c1-9-6-12(8-14(19)15(17)18)7-10(2)13(9)5-4-11(3)16/h6-7,14,19H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | ALZGERIBQUWPHW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|