About (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate
(2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate (PubChem CID 23510829) has the molecular formula C14H17ClO4
and a molecular weight of 284.74 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate.
Analyze (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate (CID 23510829) is (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate is CCOC(=O)COC(=O)Cc1c(C)cc(C)cc1Cl.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate?
The InChIKey is KGLNLCYPCBHRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO4/c1-4-18-14(17)8-19-13(16)7-11-10(3)5-9(2)6-12(11)15/h5-6H,4,7-8H2,1-3H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate?
(2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate has a molecular weight of 284.74 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 2-(2-chloro-4,6-dimethylphenyl)acetate is sourced from PubChem (CID 23510829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).