C14H12ClN3 — CID 82120847
6-(2-chloro-4,6-dimethylanilino)pyridine-3-carbonitrile (PubChem CID 82120847) has the molecular formula C14H12ClN3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 6-(2-chloro-4,6-dimethylanilino)pyridine-3-carbonitrile.
| Compound Name | 6-(2-chloro-4,6-dimethylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82120847 |
| Molecular Formula | C14H12ClN3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 6-(2-chloro-4,6-dimethylanilino)pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(Nc2ccc(C#N)cn2)c(Cl)c1 |
| InChI | InChI=1S/C14H12ClN3/c1-9-5-10(2)14(12(15)6-9)18-13-4-3-11(7-16)8-17-13/h3-6,8H,1-2H3,(H,17,18) |
| InChIKey | ZXRWGLSGWVSSCO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |