C12H6ClF2N3 — CID 83087105
6-(2-chloro-4,6-difluoroanilino)pyridine-3-carbonitrile (PubChem CID 83087105) has the molecular formula C12H6ClF2N3 and a molecular weight of 265.65 g/mol. Its IUPAC name is 6-(2-chloro-4,6-difluoroanilino)pyridine-3-carbonitrile.
| Compound Name | 6-(2-chloro-4,6-difluoroanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 83087105 |
| Molecular Formula | C12H6ClF2N3 |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 6-(2-chloro-4,6-difluoroanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2c(F)cc(F)cc2Cl)nc1 |
| InChI | InChI=1S/C12H6ClF2N3/c13-9-3-8(14)4-10(15)12(9)18-11-2-1-7(5-16)6-17-11/h1-4,6H,(H,17,18) |
| InChIKey | OHTSTTHCZUPBQZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |