C12H6F3N3 — CID 55119031
6-(3,4,5-trifluoroanilino)pyridine-3-carbonitrile (PubChem CID 55119031) has the molecular formula C12H6F3N3 and a molecular weight of 249.20 g/mol. Its IUPAC name is 6-(3,4,5-trifluoroanilino)pyridine-3-carbonitrile.
| Compound Name | 6-(3,4,5-trifluoroanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 55119031 |
| Molecular Formula | C12H6F3N3 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 6-(3,4,5-trifluoroanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C12H6F3N3/c13-9-3-8(4-10(14)12(9)15)18-11-2-1-7(5-16)6-17-11/h1-4,6H,(H,17,18) |
| InChIKey | ZIQVAKRBBOAFNH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|