C12H8F3N3S — CID 62813563
6-(3,4,5-trifluoroanilino)pyridine-3-carbothioamide (PubChem CID 62813563) has the molecular formula C12H8F3N3S and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-(3,4,5-trifluoroanilino)pyridine-3-carbothioamide.
| Compound Name | 6-(3,4,5-trifluoroanilino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62813563 |
| Molecular Formula | C12H8F3N3S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 6-(3,4,5-trifluoroanilino)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(Nc2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C12H8F3N3S/c13-8-3-7(4-9(14)11(8)15)18-10-2-1-6(5-17-10)12(16)19/h1-5H,(H2,16,19)(H,17,18) |
| InChIKey | KBEQRHQZBUGQFN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|