C13H11BrFN3S — CID 107592467
6-(5-bromo-4-fluoro-2-methylanilino)pyridine-3-carbothioamide (PubChem CID 107592467) has the molecular formula C13H11BrFN3S and a molecular weight of 340.22 g/mol. Its IUPAC name is 6-(5-bromo-4-fluoro-2-methylanilino)pyridine-3-carbothioamide.
| Compound Name | 6-(5-bromo-4-fluoro-2-methylanilino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107592467 |
| Molecular Formula | C13H11BrFN3S |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 6-(5-bromo-4-fluoro-2-methylanilino)pyridine-3-carbothioamide |
| SMILES | Cc1cc(F)c(Br)cc1Nc1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C13H11BrFN3S/c1-7-4-10(15)9(14)5-11(7)18-12-3-2-8(6-17-12)13(16)19/h2-6H,1H3,(H2,16,19)(H,17,18) |
| InChIKey | QONPYZLCEUDXMU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|