C11H12BrFN6 — CID 107594483
4-N-(5-bromo-4-fluoro-2-methylphenyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 107594483) has the molecular formula C11H12BrFN6 and a molecular weight of 327.16 g/mol. Its IUPAC name is 4-N-(5-bromo-4-fluoro-2-methylphenyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-bromo-4-fluoro-2-methylphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 107594483 |
| Molecular Formula | C11H12BrFN6 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 4-N-(5-bromo-4-fluoro-2-methylphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(F)c(Br)cc1Nc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C11H12BrFN6/c1-5-2-7(13)6(12)3-8(5)16-9-4-10(19-15)18-11(14)17-9/h2-4H,15H2,1H3,(H4,14,16,17,18,19) |
| InChIKey | NUSYFMGNMLFWDP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|