C12H7BrClF4N3 — CID 107593354
N-(5-bromo-4-fluoro-2-methylphenyl)-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107593354) has the molecular formula C12H7BrClF4N3 and a molecular weight of 384.56 g/mol. Its IUPAC name is N-(5-bromo-4-fluoro-2-methylphenyl)-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(5-bromo-4-fluoro-2-methylphenyl)-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107593354 |
| Molecular Formula | C12H7BrClF4N3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | N-(5-bromo-4-fluoro-2-methylphenyl)-6-chloro-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(F)c(Br)cc1Nc1cc(Cl)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H7BrClF4N3/c1-5-2-7(15)6(13)3-8(5)19-10-4-9(14)20-11(21-10)12(16,17)18/h2-4H,1H3,(H,19,20,21) |
| InChIKey | BLQYVEICBXJMIO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |