C14H14BrClFN3 — CID 80948291
N-(4-bromo-2-fluorophenyl)-2-tert-butyl-6-chloropyrimidin-4-amine (PubChem CID 80948291) has the molecular formula C14H14BrClFN3 and a molecular weight of 358.64 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-tert-butyl-6-chloropyrimidin-4-amine.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-tert-butyl-6-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 80948291 |
| Molecular Formula | C14H14BrClFN3 |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-tert-butyl-6-chloropyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(Cl)cc(Nc2ccc(Br)cc2F)n1 |
| InChI | InChI=1S/C14H14BrClFN3/c1-14(2,3)13-19-11(16)7-12(20-13)18-10-5-4-8(15)6-9(10)17/h4-7H,1-3H3,(H,18,19,20) |
| InChIKey | FZXBDRJSFRODPP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |