C15H17BrClN3 — CID 80951056
N-(3-bromo-4-methylphenyl)-2-tert-butyl-6-chloropyrimidin-4-amine (PubChem CID 80951056) has the molecular formula C15H17BrClN3 and a molecular weight of 354.68 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-2-tert-butyl-6-chloropyrimidin-4-amine.
| Compound Name | N-(3-bromo-4-methylphenyl)-2-tert-butyl-6-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 80951056 |
| Molecular Formula | C15H17BrClN3 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-2-tert-butyl-6-chloropyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2cc(Cl)nc(C(C)(C)C)n2)cc1Br |
| InChI | InChI=1S/C15H17BrClN3/c1-9-5-6-10(7-11(9)16)18-13-8-12(17)19-14(20-13)15(2,3)4/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | AIIXKSGPNPWYPF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |