C13H10BrF2N3S — CID 102853931
2-(5-bromo-2,4-difluoroanilino)-4-methylpyridine-3-carbothioamide (PubChem CID 102853931) has the molecular formula C13H10BrF2N3S and a molecular weight of 358.21 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluoroanilino)-4-methylpyridine-3-carbothioamide.
| Compound Name | 2-(5-bromo-2,4-difluoroanilino)-4-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 102853931 |
| Molecular Formula | C13H10BrF2N3S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-(5-bromo-2,4-difluoroanilino)-4-methylpyridine-3-carbothioamide |
| SMILES | Cc1ccnc(Nc2cc(Br)c(F)cc2F)c1C(N)=S |
| InChI | InChI=1S/C13H10BrF2N3S/c1-6-2-3-18-13(11(6)12(17)20)19-10-4-7(14)8(15)5-9(10)16/h2-5H,1H3,(H2,17,20)(H,18,19) |
| InChIKey | HSKFZTLBIZZGCP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|