C9H11F2N3S — CID 115407203
2-(2,2-difluoroethylamino)-4-methylpyridine-3-carbothioamide (PubChem CID 115407203) has the molecular formula C9H11F2N3S and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-4-methylpyridine-3-carbothioamide.
| Compound Name | 2-(2,2-difluoroethylamino)-4-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 115407203 |
| Molecular Formula | C9H11F2N3S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-4-methylpyridine-3-carbothioamide |
| SMILES | Cc1ccnc(NCC(F)F)c1C(N)=S |
| InChI | InChI=1S/C9H11F2N3S/c1-5-2-3-13-9(7(5)8(12)15)14-4-6(10)11/h2-3,6H,4H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | WVLUCOFUIRMGFD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|