C8H9F2N3S — CID 115407232
4-(2,2-difluoroethylamino)pyridine-2-carbothioamide (PubChem CID 115407232) has the molecular formula C8H9F2N3S and a molecular weight of 217.24 g/mol. Its IUPAC name is 4-(2,2-difluoroethylamino)pyridine-2-carbothioamide.
| Compound Name | 4-(2,2-difluoroethylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 115407232 |
| Molecular Formula | C8H9F2N3S |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4-(2,2-difluoroethylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(NCC(F)F)ccn1 |
| InChI | InChI=1S/C8H9F2N3S/c9-7(10)4-13-5-1-2-12-6(3-5)8(11)14/h1-3,7H,4H2,(H2,11,14)(H,12,13) |
| InChIKey | CLAAZMCFSMGWBW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|