C11H11N5S — CID 114111088
4-(pyrimidin-4-ylmethylamino)pyridine-2-carbothioamide (PubChem CID 114111088) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-(pyrimidin-4-ylmethylamino)pyridine-2-carbothioamide.
| Compound Name | 4-(pyrimidin-4-ylmethylamino)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114111088 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-(pyrimidin-4-ylmethylamino)pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(NCc2ccncn2)ccn1 |
| InChI | InChI=1S/C11H11N5S/c12-11(17)10-5-8(2-4-14-10)15-6-9-1-3-13-7-16-9/h1-5,7H,6H2,(H2,12,17)(H,14,15) |
| InChIKey | HUGZXGDSJYKJGB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|