C13H19N3O2S — CID 104761865
2-[(3-methoxyoxolan-3-yl)methylamino]-4-methylpyridine-3-carbothioamide (PubChem CID 104761865) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[(3-methoxyoxolan-3-yl)methylamino]-4-methylpyridine-3-carbothioamide.
| Compound Name | 2-[(3-methoxyoxolan-3-yl)methylamino]-4-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 104761865 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[(3-methoxyoxolan-3-yl)methylamino]-4-methylpyridine-3-carbothioamide |
| SMILES | COC1(CNc2nccc(C)c2C(N)=S)CCOC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-9-3-5-15-12(10(9)11(14)19)16-7-13(17-2)4-6-18-8-13/h3,5H,4,6-8H2,1-2H3,(H2,14,19)(H,15,16) |
| InChIKey | OSBUSLXHCOBKHQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|