C13H16F2N2O2S — CID 104761871
3,5-difluoro-4-[(3-methoxyoxolan-3-yl)methylamino]benzenecarbothioamide (PubChem CID 104761871) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 3,5-difluoro-4-[(3-methoxyoxolan-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-[(3-methoxyoxolan-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 104761871 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3,5-difluoro-4-[(3-methoxyoxolan-3-yl)methylamino]benzenecarbothioamide |
| SMILES | COC1(CNc2c(F)cc(C(N)=S)cc2F)CCOC1 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-18-13(2-3-19-7-13)6-17-11-9(14)4-8(12(16)20)5-10(11)15/h4-5,17H,2-3,6-7H2,1H3,(H2,16,20) |
| InChIKey | OQJDGZFSZFLTFP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|