C12H16F3N3S — CID 115519906
4-methyl-2-(5,5,5-trifluoropentylamino)pyridine-3-carbothioamide (PubChem CID 115519906) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is 4-methyl-2-(5,5,5-trifluoropentylamino)pyridine-3-carbothioamide.
| Compound Name | 4-methyl-2-(5,5,5-trifluoropentylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 115519906 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-methyl-2-(5,5,5-trifluoropentylamino)pyridine-3-carbothioamide |
| SMILES | Cc1ccnc(NCCCCC(F)(F)F)c1C(N)=S |
| InChI | InChI=1S/C12H16F3N3S/c1-8-4-7-18-11(9(8)10(16)19)17-6-3-2-5-12(13,14)15/h4,7H,2-3,5-6H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | FPPVJPJGZNXSMC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|