C13H8BrF3N2S — CID 102853938
4-(5-bromo-2,4-difluoroanilino)-2-fluorobenzenecarbothioamide (PubChem CID 102853938) has the molecular formula C13H8BrF3N2S and a molecular weight of 361.19 g/mol. Its IUPAC name is 4-(5-bromo-2,4-difluoroanilino)-2-fluorobenzenecarbothioamide.
| Compound Name | 4-(5-bromo-2,4-difluoroanilino)-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 102853938 |
| Molecular Formula | C13H8BrF3N2S |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 4-(5-bromo-2,4-difluoroanilino)-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Nc2cc(Br)c(F)cc2F)cc1F |
| InChI | InChI=1S/C13H8BrF3N2S/c14-8-4-12(11(17)5-10(8)16)19-6-1-2-7(13(18)20)9(15)3-6/h1-5,19H,(H2,18,20) |
| InChIKey | PVTUSSJZCVYQRV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|