C12H11BrF2N4S — CID 102853926
5-(5-bromo-2,4-difluoroanilino)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 102853926) has the molecular formula C12H11BrF2N4S and a molecular weight of 361.22 g/mol. Its IUPAC name is 5-(5-bromo-2,4-difluoroanilino)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(5-bromo-2,4-difluoroanilino)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 102853926 |
| Molecular Formula | C12H11BrF2N4S |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 5-(5-bromo-2,4-difluoroanilino)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(Nc2cc(Br)c(F)cc2F)c1C(N)=S |
| InChI | InChI=1S/C12H11BrF2N4S/c1-5-10(11(16)20)12(19(2)18-5)17-9-3-6(13)7(14)4-8(9)15/h3-4,17H,1-2H3,(H2,16,20) |
| InChIKey | DRQNABAVWFHACP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|