C14H15N5S2 — CID 63758053
1,3-dimethyl-5-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrazole-4-carbothioamide (PubChem CID 63758053) has the molecular formula C14H15N5S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758053 |
| Molecular Formula | C14H15N5S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1,3-dimethyl-5-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrazole-4-carbothioamide |
| SMILES | Cc1ccc2nc(Nc3c(C(N)=S)c(C)nn3C)sc2c1 |
| InChI | InChI=1S/C14H15N5S2/c1-7-4-5-9-10(6-7)21-14(16-9)17-13-11(12(15)20)8(2)18-19(13)3/h4-6H,1-3H3,(H2,15,20)(H,16,17) |
| InChIKey | VAFXAPUPXYSMFK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|