C15H12ClN3S2 — CID 63515168
2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-methylbenzenecarbothioamide (PubChem CID 63515168) has the molecular formula C15H12ClN3S2 and a molecular weight of 333.87 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-methylbenzenecarbothioamide.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 63515168 |
| Molecular Formula | C15H12ClN3S2 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-4-methylbenzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C15H12ClN3S2/c1-8-2-4-10(14(17)20)12(6-8)19-15-18-11-5-3-9(16)7-13(11)21-15/h2-7H,1H3,(H2,17,20)(H,18,19) |
| InChIKey | KPNDJKBTUYBUOC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|