C14H10ClN3S2 — CID 63519398
2-(1,3-benzothiazol-2-ylamino)-5-chlorobenzenecarbothioamide (PubChem CID 63519398) has the molecular formula C14H10ClN3S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-5-chlorobenzenecarbothioamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-5-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63519398 |
| Molecular Formula | C14H10ClN3S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-5-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)ccc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H10ClN3S2/c15-8-5-6-10(9(7-8)13(16)19)17-14-18-11-3-1-2-4-12(11)20-14/h1-7H,(H2,16,19)(H,17,18) |
| InChIKey | IXDZSKJCROGDQK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|