C12H11BrFN3OS — CID 55243085
5-(4-bromo-2-fluorophenoxy)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 55243085) has the molecular formula C12H11BrFN3OS and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-(4-bromo-2-fluorophenoxy)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(4-bromo-2-fluorophenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 55243085 |
| Molecular Formula | C12H11BrFN3OS |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 5-(4-bromo-2-fluorophenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(Oc2ccc(Br)cc2F)c1C(N)=S |
| InChI | InChI=1S/C12H11BrFN3OS/c1-6-10(11(15)19)12(17(2)16-6)18-9-4-3-7(13)5-8(9)14/h3-5H,1-2H3,(H2,15,19) |
| InChIKey | VLHLMAVYLXDROS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|