C14H16ClN3OS — CID 63752296
5-(4-chloro-3,5-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63752296) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 5-(4-chloro-3,5-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(4-chloro-3,5-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63752296 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-(4-chloro-3,5-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1cc(Oc2c(C(N)=S)c(C)nn2C)cc(C)c1Cl |
| InChI | InChI=1S/C14H16ClN3OS/c1-7-5-10(6-8(2)12(7)15)19-14-11(13(16)20)9(3)17-18(14)4/h5-6H,1-4H3,(H2,16,20) |
| InChIKey | UWXDFSSRXMXZSQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|