C7H11N3OS — CID 63756722
5-methoxy-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63756722) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 5-methoxy-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-methoxy-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756722 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 5-methoxy-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | COc1c(C(N)=S)c(C)nn1C |
| InChI | InChI=1S/C7H11N3OS/c1-4-5(6(8)12)7(11-3)10(2)9-4/h1-3H3,(H2,8,12) |
| InChIKey | KTMISCRQFJMEQK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|