C12H21N3OS — CID 63758804
1,3-dimethyl-5-(4-methylpentan-2-yloxy)pyrazole-4-carbothioamide (PubChem CID 63758804) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-methylpentan-2-yloxy)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(4-methylpentan-2-yloxy)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758804 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1,3-dimethyl-5-(4-methylpentan-2-yloxy)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(OC(C)CC(C)C)c1C(N)=S |
| InChI | InChI=1S/C12H21N3OS/c1-7(2)6-8(3)16-12-10(11(13)17)9(4)14-15(12)5/h7-8H,6H2,1-5H3,(H2,13,17) |
| InChIKey | GNXGAXFGYAWFEL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|