C11H8BrF2N3 — CID 107608978
2-N-(4-bromo-2,5-difluorophenyl)pyridine-2,5-diamine (PubChem CID 107608978) has the molecular formula C11H8BrF2N3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 2-N-(4-bromo-2,5-difluorophenyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(4-bromo-2,5-difluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 107608978 |
| Molecular Formula | C11H8BrF2N3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 2-N-(4-bromo-2,5-difluorophenyl)pyridine-2,5-diamine |
| SMILES | Nc1ccc(Nc2cc(F)c(Br)cc2F)nc1 |
| InChI | InChI=1S/C11H8BrF2N3/c12-7-3-9(14)10(4-8(7)13)17-11-2-1-6(15)5-16-11/h1-5H,15H2,(H,16,17) |
| InChIKey | YKNBEQMDNULIBB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_no_alk_A(1)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|