C16H19N3 — CID 143918294
6-(2,5-dimethylanilino)pyridine-3-carbonitrile;ethane (PubChem CID 143918294) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 6-(2,5-dimethylanilino)pyridine-3-carbonitrile;ethane.
| Compound Name | 6-(2,5-dimethylanilino)pyridine-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 143918294 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 6-(2,5-dimethylanilino)pyridine-3-carbonitrile;ethane |
| SMILES | CC.Cc1ccc(C)c(Nc2ccc(C#N)cn2)c1 |
| InChI | InChI=1S/C14H13N3.C2H6/c1-10-3-4-11(2)13(7-10)17-14-6-5-12(8-15)9-16-14;1-2/h3-7,9H,1-2H3,(H,16,17);1-2H3 |
| InChIKey | NBUSUGOUQBKAJT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |