C15H3BrCl3N5O2 — CID 89300273
4-(2-bromo-6-cyano-4-nitroanilino)-2,5,6-trichlorobenzene-1,3-dicarbonitrile (PubChem CID 89300273) has the molecular formula C15H3BrCl3N5O2 and a molecular weight of 471.49 g/mol. Its IUPAC name is 4-(2-bromo-6-cyano-4-nitroanilino)-2,5,6-trichlorobenzene-1,3-dicarbonitrile.
| Compound Name | 4-(2-bromo-6-cyano-4-nitroanilino)-2,5,6-trichlorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 89300273 |
| Molecular Formula | C15H3BrCl3N5O2 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 468.85 |
| IUPAC Name | 4-(2-bromo-6-cyano-4-nitroanilino)-2,5,6-trichlorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cc(Br)c1Nc1c(Cl)c(Cl)c(C#N)c(Cl)c1C#N |
| InChI | InChI=1S/C15H3BrCl3N5O2/c16-10-2-7(24(25)26)1-6(3-20)14(10)23-15-9(5-22)11(17)8(4-21)12(18)13(15)19/h1-2,23H |
| InChIKey | ANLGDRQVVFFRDR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|