C14H3Cl5N4O2 — CID 89305085
3,4,6-trichloro-5-(2,6-dichloro-4-nitroanilino)benzene-1,2-dicarbonitrile (PubChem CID 89305085) has the molecular formula C14H3Cl5N4O2 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3,4,6-trichloro-5-(2,6-dichloro-4-nitroanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trichloro-5-(2,6-dichloro-4-nitroanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 89305085 |
| Molecular Formula | C14H3Cl5N4O2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 433.87 |
| IUPAC Name | 3,4,6-trichloro-5-(2,6-dichloro-4-nitroanilino)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)c(Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)c(Cl)c1C#N |
| InChI | InChI=1S/C14H3Cl5N4O2/c15-8-1-5(23(24)25)2-9(16)13(8)22-14-11(18)7(4-21)6(3-20)10(17)12(14)19/h1-2,22H |
| InChIKey | UPQJTASMCHNMSQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|