C16H9Cl3N4O4 — CID 90307343
4-chloro-6-(2,6-dichloro-4-nitroanilino)-2,5-dimethoxybenzene-1,3-dicarbonitrile (PubChem CID 90307343) has the molecular formula C16H9Cl3N4O4 and a molecular weight of 427.63 g/mol. Its IUPAC name is 4-chloro-6-(2,6-dichloro-4-nitroanilino)-2,5-dimethoxybenzene-1,3-dicarbonitrile.
| Compound Name | 4-chloro-6-(2,6-dichloro-4-nitroanilino)-2,5-dimethoxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90307343 |
| Molecular Formula | C16H9Cl3N4O4 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | 4-chloro-6-(2,6-dichloro-4-nitroanilino)-2,5-dimethoxybenzene-1,3-dicarbonitrile |
| SMILES | COc1c(C#N)c(Cl)c(OC)c(Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)c1C#N |
| InChI | InChI=1S/C16H9Cl3N4O4/c1-26-15-8(5-20)12(19)16(27-2)13(9(15)6-21)22-14-10(17)3-7(23(24)25)4-11(14)18/h3-4,22H,1-2H3 |
| InChIKey | SLSVGEMAYUEWSK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|