C10H4Cl2N4O2 — CID 168511701
2-[(2,6-dichloro-4-nitroanilino)methylidene]propanedinitrile (PubChem CID 168511701) has the molecular formula C10H4Cl2N4O2 and a molecular weight of 283.07 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-nitroanilino)methylidene]propanedinitrile.
| Compound Name | 2-[(2,6-dichloro-4-nitroanilino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168511701 |
| Molecular Formula | C10H4Cl2N4O2 |
| Molecular Weight | 283.07 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | 2-[(2,6-dichloro-4-nitroanilino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H4Cl2N4O2/c11-8-1-7(16(17)18)2-9(12)10(8)15-5-6(3-13)4-14/h1-2,5,15H |
| InChIKey | JTXNVGAPLCBCDC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|