C11H5BrN4O4 — CID 168542795
5-bromo-2-(2,2-dicyanoethenylamino)-3-nitrobenzoic acid (PubChem CID 168542795) has the molecular formula C11H5BrN4O4 and a molecular weight of 337.09 g/mol. Its IUPAC name is 5-bromo-2-(2,2-dicyanoethenylamino)-3-nitrobenzoic acid.
| Compound Name | 5-bromo-2-(2,2-dicyanoethenylamino)-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 168542795 |
| Molecular Formula | C11H5BrN4O4 |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 5-bromo-2-(2,2-dicyanoethenylamino)-3-nitrobenzoic acid |
| SMILES | N#CC(C#N)=CNc1c(C(=O)O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H5BrN4O4/c12-7-1-8(11(17)18)10(9(2-7)16(19)20)15-5-6(3-13)4-14/h1-2,5,15H,(H,17,18) |
| InChIKey | PIEKSWVQUCJSNE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 140.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|