C10H4N6O6 — CID 169341705
2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dinitrobenzoic acid (PubChem CID 169341705) has the molecular formula C10H4N6O6 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dinitrobenzoic acid.
| Compound Name | 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 169341705 |
| Molecular Formula | C10H4N6O6 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[2-(dicyanomethylidene)hydrazinyl]-3,5-dinitrobenzoic acid |
| SMILES | N#CC(C#N)=NNc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H4N6O6/c11-3-5(4-12)13-14-9-7(10(17)18)1-6(15(19)20)2-8(9)16(21)22/h1-2,14H,(H,17,18) |
| InChIKey | IJYNIFBZJDEAHL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 195.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|