C11H8N6O5 — CID 169340860
2-[[2-(2-hydroxyethyl)-3,5-dinitrophenyl]hydrazinylidene]propanedinitrile (PubChem CID 169340860) has the molecular formula C11H8N6O5 and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-[[2-(2-hydroxyethyl)-3,5-dinitrophenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-(2-hydroxyethyl)-3,5-dinitrophenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340860 |
| Molecular Formula | C11H8N6O5 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[[2-(2-hydroxyethyl)-3,5-dinitrophenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1CCO |
| InChI | InChI=1S/C11H8N6O5/c12-5-7(6-13)14-15-10-3-8(16(19)20)4-11(17(21)22)9(10)1-2-18/h3-4,15,18H,1-2H2 |
| InChIKey | PEDMMZBVDJHWAP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 178.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|