C14H11N5O3 — CID 169339232
2-[(2,2-dimethyl-7-nitrochromen-6-yl)hydrazinylidene]propanedinitrile (PubChem CID 169339232) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-7-nitrochromen-6-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(2,2-dimethyl-7-nitrochromen-6-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339232 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[(2,2-dimethyl-7-nitrochromen-6-yl)hydrazinylidene]propanedinitrile |
| SMILES | CC1(C)C=Cc2cc(NN=C(C#N)C#N)c([N+](=O)[O-])cc2O1 |
| InChI | InChI=1S/C14H11N5O3/c1-14(2)4-3-9-5-11(18-17-10(7-15)8-16)12(19(20)21)6-13(9)22-14/h3-6,18H,1-2H3 |
| InChIKey | UXNDFTZBBUJDEK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|