C25H32N2O4 — CID 142867747
2,2-dimethylchromen-7-amine;2,2-dimethyl-7-nitrochromene;propane (PubChem CID 142867747) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2,2-dimethylchromen-7-amine;2,2-dimethyl-7-nitrochromene;propane.
| Compound Name | 2,2-dimethylchromen-7-amine;2,2-dimethyl-7-nitrochromene;propane |
|---|---|
| PubChem CID | 142867747 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 2,2-dimethylchromen-7-amine;2,2-dimethyl-7-nitrochromene;propane |
| SMILES | CC1(C)C=Cc2ccc(N)cc2O1.CC1(C)C=Cc2ccc([N+](=O)[O-])cc2O1.CCC |
| InChI | InChI=1S/C11H11NO3.C11H13NO.C3H8/c1-11(2)6-5-8-3-4-9(12(13)14)7-10(8)15-11;1-11(2)6-5-8-3-4-9(12)7-10(8)13-11;1-3-2/h3-7H,1-2H3;3-7H,12H2,1-2H3;3H2,1-2H3 |
| InChIKey | YCEVITOPPWJSJG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|