C25H20N2O4 — CID 165164653
(3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone (PubChem CID 165164653) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone.
| Compound Name | (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone |
|---|---|
| PubChem CID | 165164653 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone |
| SMILES | CC1(C)c2cc(C(=O)c3ccccc3)ccc2NC12C=Cc1ccc([N+](=O)[O-])cc1O2 |
| InChI | InChI=1S/C25H20N2O4/c1-24(2)20-14-18(23(28)17-6-4-3-5-7-17)9-11-21(20)26-25(24)13-12-16-8-10-19(27(29)30)15-22(16)31-25/h3-15,26H,1-2H3 |
| InChIKey | VFBARAJMHPTRGB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|