About (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone
(3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone (PubChem CID 165164653) has the molecular formula C25H20N2O4
and a molecular weight of 412.45 g/mol. Its IUPAC name is (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone |
| PubChem CID | 165164653 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone |
| SMILES | CC1(C)c2cc(C(=O)c3ccccc3)ccc2NC12C=Cc1ccc([N+](=O)[O-])cc1O2 |
| InChI | InChI=1S/C25H20N2O4/c1-24(2)20-14-18(23(28)17-6-4-3-5-7-17)9-11-21(20)26-25(24)13-12-16-8-10-19(27(29)30)15-22(16)31-25/h3-15,26H,1-2H3 |
| InChIKey | VFBARAJMHPTRGB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone?
The IUPAC name of (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone (CID 165164653) is (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone.
What is the SMILES notation for (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone?
The canonical SMILES for (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone is CC1(C)c2cc(C(=O)c3ccccc3)ccc2NC12C=Cc1ccc([N+](=O)[O-])cc1O2.
What is the InChIKey of (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone?
The InChIKey is VFBARAJMHPTRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O4/c1-24(2)20-14-18(23(28)17-6-4-3-5-7-17)9-11-21(20)26-25(24)13-12-16-8-10-19(27(29)30)15-22(16)31-25/h3-15,26H,1-2H3.
What are the key properties of (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone?
(3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone has a molecular weight of 412.45 g/mol, XLogP of 5.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-7'-nitrospiro[1H-indole-2,2'-chromene]-5-yl)-phenylmethanone is sourced from PubChem (CID 165164653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).