C24H28N2O4 — CID 162256850
2,2,5-trimethylchromen-6-amine;2,2,5-trimethyl-6-nitrochromene (PubChem CID 162256850) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2,2,5-trimethylchromen-6-amine;2,2,5-trimethyl-6-nitrochromene.
| Compound Name | 2,2,5-trimethylchromen-6-amine;2,2,5-trimethyl-6-nitrochromene |
|---|---|
| PubChem CID | 162256850 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2,2,5-trimethylchromen-6-amine;2,2,5-trimethyl-6-nitrochromene |
| SMILES | Cc1c(N)ccc2c1C=CC(C)(C)O2.Cc1c([N+](=O)[O-])ccc2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C12H13NO3.C12H15NO/c1-8-9-6-7-12(2,3)16-11(9)5-4-10(8)13(14)15;1-8-9-6-7-12(2,3)14-11(9)5-4-10(8)13/h4-7H,1-3H3;4-7H,13H2,1-3H3 |
| InChIKey | ZYSAOVFZRZEZIF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|