C11H13NO3 — CID 59127239
2-ethyl-4-methyl-5-nitro-2,3-dihydro-1-benzofuran (PubChem CID 59127239) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-ethyl-4-methyl-5-nitro-2,3-dihydro-1-benzofuran.
| Compound Name | 2-ethyl-4-methyl-5-nitro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 59127239 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-ethyl-4-methyl-5-nitro-2,3-dihydro-1-benzofuran |
| SMILES | CCC1Cc2c(ccc([N+](=O)[O-])c2C)O1 |
| InChI | InChI=1S/C11H13NO3/c1-3-8-6-9-7(2)10(12(13)14)4-5-11(9)15-8/h4-5,8H,3,6H2,1-2H3 |
| InChIKey | GILDALLHVGHWDR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|