C9H10FNO2 — CID 118819005
1-(fluoromethyl)-2,3-dimethyl-4-nitrobenzene (PubChem CID 118819005) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is 1-(fluoromethyl)-2,3-dimethyl-4-nitrobenzene.
| Compound Name | 1-(fluoromethyl)-2,3-dimethyl-4-nitrobenzene |
|---|---|
| PubChem CID | 118819005 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-(fluoromethyl)-2,3-dimethyl-4-nitrobenzene |
| SMILES | Cc1c(CF)ccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H10FNO2/c1-6-7(2)9(11(12)13)4-3-8(6)5-10/h3-4H,5H2,1-2H3 |
| InChIKey | BRZQLJWBMQPCAR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|