C9H12N2O2 — CID 126991962
N,2,6-trimethyl-3-nitroaniline (PubChem CID 126991962) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is N,2,6-trimethyl-3-nitroaniline.
| Compound Name | N,2,6-trimethyl-3-nitroaniline |
|---|---|
| PubChem CID | 126991962 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N,2,6-trimethyl-3-nitroaniline |
| SMILES | CNc1c(C)ccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H12N2O2/c1-6-4-5-8(11(12)13)7(2)9(6)10-3/h4-5,10H,1-3H3 |
| InChIKey | ZXHGWASHDSXKDM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|