C21H36N4O3 — CID 156707891
N',N'-dimethyl-N-[2-[[methyl(3-methylpentyl)amino]methyl]-5-nitro-2,3-dihydro-1-benzofuran-4-yl]propane-1,3-diamine (PubChem CID 156707891) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[[methyl(3-methylpentyl)amino]methyl]-5-nitro-2,3-dihydro-1-benzofuran-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[[methyl(3-methylpentyl)amino]methyl]-5-nitro-2,3-dihydro-1-benzofuran-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 156707891 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | N',N'-dimethyl-N-[2-[[methyl(3-methylpentyl)amino]methyl]-5-nitro-2,3-dihydro-1-benzofuran-4-yl]propane-1,3-diamine |
| SMILES | CCC(C)CCN(C)CC1Cc2c(ccc([N+](=O)[O-])c2NCCCN(C)C)O1 |
| InChI | InChI=1S/C21H36N4O3/c1-6-16(2)10-13-24(5)15-17-14-18-20(28-17)9-8-19(25(26)27)21(18)22-11-7-12-23(3)4/h8-9,16-17,22H,6-7,10-15H2,1-5H3 |
| InChIKey | FZOFRLSGRXQZLC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|