C16H26FN3O2 — CID 162023165
N-[3-fluoro-2-(2-methylbutyl)-6-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 162023165) has the molecular formula C16H26FN3O2 and a molecular weight of 311.40 g/mol. Its IUPAC name is N-[3-fluoro-2-(2-methylbutyl)-6-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-fluoro-2-(2-methylbutyl)-6-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 162023165 |
| Molecular Formula | C16H26FN3O2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[3-fluoro-2-(2-methylbutyl)-6-nitrophenyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCC(C)Cc1c(F)ccc([N+](=O)[O-])c1NCCCN(C)C |
| InChI | InChI=1S/C16H26FN3O2/c1-5-12(2)11-13-14(17)7-8-15(20(21)22)16(13)18-9-6-10-19(3)4/h7-8,12,18H,5-6,9-11H2,1-4H3 |
| InChIKey | HKGWCFBJQYLGCE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|