C10H12F2N2O3 — CID 106842471
4-(2,3-difluoro-6-nitroanilino)butan-1-ol (PubChem CID 106842471) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is 4-(2,3-difluoro-6-nitroanilino)butan-1-ol.
| Compound Name | 4-(2,3-difluoro-6-nitroanilino)butan-1-ol |
|---|---|
| PubChem CID | 106842471 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(2,3-difluoro-6-nitroanilino)butan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(F)c(F)c1NCCCCO |
| InChI | InChI=1S/C10H12F2N2O3/c11-7-3-4-8(14(16)17)10(9(7)12)13-5-1-2-6-15/h3-4,13,15H,1-2,5-6H2 |
| InChIKey | ZUULMHZEXKXHQA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|