C10H13F2N3O3 — CID 64540429
3-amino-4-(2,3-difluoro-6-nitroanilino)butan-2-ol (PubChem CID 64540429) has the molecular formula C10H13F2N3O3 and a molecular weight of 261.23 g/mol. Its IUPAC name is 3-amino-4-(2,3-difluoro-6-nitroanilino)butan-2-ol.
| Compound Name | 3-amino-4-(2,3-difluoro-6-nitroanilino)butan-2-ol |
|---|---|
| PubChem CID | 64540429 |
| Molecular Formula | C10H13F2N3O3 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-amino-4-(2,3-difluoro-6-nitroanilino)butan-2-ol |
| SMILES | CC(O)C(N)CNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C10H13F2N3O3/c1-5(16)7(13)4-14-10-8(15(17)18)3-2-6(11)9(10)12/h2-3,5,7,14,16H,4,13H2,1H3 |
| InChIKey | LLMLVFLKLOAUNL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|