C11H17N3O3 — CID 64540653
3-amino-4-(3-methyl-4-nitroanilino)butan-2-ol (PubChem CID 64540653) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-amino-4-(3-methyl-4-nitroanilino)butan-2-ol.
| Compound Name | 3-amino-4-(3-methyl-4-nitroanilino)butan-2-ol |
|---|---|
| PubChem CID | 64540653 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 3-amino-4-(3-methyl-4-nitroanilino)butan-2-ol |
| SMILES | Cc1cc(NCC(N)C(C)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O3/c1-7-5-9(3-4-11(7)14(16)17)13-6-10(12)8(2)15/h3-5,8,10,13,15H,6,12H2,1-2H3 |
| InChIKey | BNCVONXGGUJMMB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|