C15H22N2O4 — CID 107475161
4,4-dimethyl-2-[(3-methyl-4-nitroanilino)methyl]pentanoic acid (PubChem CID 107475161) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4,4-dimethyl-2-[(3-methyl-4-nitroanilino)methyl]pentanoic acid.
| Compound Name | 4,4-dimethyl-2-[(3-methyl-4-nitroanilino)methyl]pentanoic acid |
|---|---|
| PubChem CID | 107475161 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4,4-dimethyl-2-[(3-methyl-4-nitroanilino)methyl]pentanoic acid |
| SMILES | Cc1cc(NCC(CC(C)(C)C)C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N2O4/c1-10-7-12(5-6-13(10)17(20)21)16-9-11(14(18)19)8-15(2,3)4/h5-7,11,16H,8-9H2,1-4H3,(H,18,19) |
| InChIKey | QNPZGKPHHMYSRM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|